C15H14FNO6 — CID 168634660
dimethyl 3-(4-fluoro-2-formylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168634660) has the molecular formula C15H14FNO6 and a molecular weight of 323.28 g/mol. Its IUPAC name is dimethyl 3-(4-fluoro-2-formylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(4-fluoro-2-formylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168634660 |
| Molecular Formula | C15H14FNO6 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | dimethyl 3-(4-fluoro-2-formylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(F)cc2C=O)COC1 |
| InChI | InChI=1S/C15H14FNO6/c1-21-14(19)11-7-23-8-17(13(11)15(20)22-2)12-4-3-10(16)5-9(12)6-18/h3-6H,7-8H2,1-2H3 |
| InChIKey | PMMQZUFJHMAYJF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|