C14H12ClF2NO5 — CID 168631847
dimethyl 3-(2-chloro-3,5-difluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168631847) has the molecular formula C14H12ClF2NO5 and a molecular weight of 347.70 g/mol. Its IUPAC name is dimethyl 3-(2-chloro-3,5-difluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(2-chloro-3,5-difluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168631847 |
| Molecular Formula | C14H12ClF2NO5 |
| Molecular Weight | 347.70 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | dimethyl 3-(2-chloro-3,5-difluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(F)cc(F)c2Cl)COC1 |
| InChI | InChI=1S/C14H12ClF2NO5/c1-21-13(19)8-5-23-6-18(12(8)14(20)22-2)10-4-7(16)3-9(17)11(10)15/h3-4H,5-6H2,1-2H3 |
| InChIKey | NTBFHLUJVSJARK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|