C15H12F3NO7 — CID 168631903
3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-2,5,6-trifluorobenzoic acid (PubChem CID 168631903) has the molecular formula C15H12F3NO7 and a molecular weight of 375.26 g/mol. Its IUPAC name is 3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-2,5,6-trifluorobenzoic acid.
| Compound Name | 3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-2,5,6-trifluorobenzoic acid |
|---|---|
| PubChem CID | 168631903 |
| Molecular Formula | C15H12F3NO7 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-2,5,6-trifluorobenzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(F)c(F)c(C(=O)O)c2F)COC1 |
| InChI | InChI=1S/C15H12F3NO7/c1-24-14(22)6-4-26-5-19(12(6)15(23)25-2)8-3-7(16)10(17)9(11(8)18)13(20)21/h3H,4-5H2,1-2H3,(H,20,21) |
| InChIKey | WEUHEGWTONURHE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|