C14H11BrF3NO5 — CID 168631972
dimethyl 3-(3-bromo-2,4,5-trifluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168631972) has the molecular formula C14H11BrF3NO5 and a molecular weight of 410.14 g/mol. Its IUPAC name is dimethyl 3-(3-bromo-2,4,5-trifluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3-bromo-2,4,5-trifluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168631972 |
| Molecular Formula | C14H11BrF3NO5 |
| Molecular Weight | 410.14 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | dimethyl 3-(3-bromo-2,4,5-trifluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(F)c(F)c(Br)c2F)COC1 |
| InChI | InChI=1S/C14H11BrF3NO5/c1-22-13(20)6-4-24-5-19(12(6)14(21)23-2)8-3-7(16)10(17)9(15)11(8)18/h3H,4-5H2,1-2H3 |
| InChIKey | LJZUOARELVEIBK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|