C17H21FN2O6 — CID 168634314
dimethyl 3-[5-fluoro-2-(2-methoxyethylamino)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168634314) has the molecular formula C17H21FN2O6 and a molecular weight of 368.36 g/mol. Its IUPAC name is dimethyl 3-[5-fluoro-2-(2-methoxyethylamino)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[5-fluoro-2-(2-methoxyethylamino)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168634314 |
| Molecular Formula | C17H21FN2O6 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | dimethyl 3-[5-fluoro-2-(2-methoxyethylamino)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COCCNc1ccc(F)cc1N1COCC(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C17H21FN2O6/c1-23-7-6-19-13-5-4-11(18)8-14(13)20-10-26-9-12(16(21)24-2)15(20)17(22)25-3/h4-5,8,19H,6-7,9-10H2,1-3H3 |
| InChIKey | UVQDDMDBGJYHET-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|