C16H12F3IN2O5 — CID 168632836
dimethyl 3-[2-cyano-6-iodo-4-(trifluoromethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168632836) has the molecular formula C16H12F3IN2O5 and a molecular weight of 496.18 g/mol. Its IUPAC name is dimethyl 3-[2-cyano-6-iodo-4-(trifluoromethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2-cyano-6-iodo-4-(trifluoromethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168632836 |
| Molecular Formula | C16H12F3IN2O5 |
| Molecular Weight | 496.18 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | dimethyl 3-[2-cyano-6-iodo-4-(trifluoromethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(I)cc(C(F)(F)F)cc2C#N)COC1 |
| InChI | InChI=1S/C16H12F3IN2O5/c1-25-14(23)10-6-27-7-22(13(10)15(24)26-2)12-8(5-21)3-9(4-11(12)20)16(17,18)19/h3-4H,6-7H2,1-2H3 |
| InChIKey | BBPGLUMZJBBYEK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|