C15H11BrClFN2O5 — CID 168634079
dimethyl 3-(4-bromo-6-chloro-2-cyano-3-fluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168634079) has the molecular formula C15H11BrClFN2O5 and a molecular weight of 433.62 g/mol. Its IUPAC name is dimethyl 3-(4-bromo-6-chloro-2-cyano-3-fluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(4-bromo-6-chloro-2-cyano-3-fluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168634079 |
| Molecular Formula | C15H11BrClFN2O5 |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | dimethyl 3-(4-bromo-6-chloro-2-cyano-3-fluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(Cl)cc(Br)c(F)c2C#N)COC1 |
| InChI | InChI=1S/C15H11BrClFN2O5/c1-23-14(21)8-5-25-6-20(13(8)15(22)24-2)12-7(4-19)11(18)9(16)3-10(12)17/h3H,5-6H2,1-2H3 |
| InChIKey | QKWCKBOMXGTSSF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|