C15H12Br2ClNO7 — CID 168633971
2-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3,5-dibromo-6-chlorobenzoic acid (PubChem CID 168633971) has the molecular formula C15H12Br2ClNO7 and a molecular weight of 513.52 g/mol. Its IUPAC name is 2-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3,5-dibromo-6-chlorobenzoic acid.
| Compound Name | 2-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3,5-dibromo-6-chlorobenzoic acid |
|---|---|
| PubChem CID | 168633971 |
| Molecular Formula | C15H12Br2ClNO7 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 510.87 |
| IUPAC Name | 2-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3,5-dibromo-6-chlorobenzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(Br)cc(Br)c(Cl)c2C(=O)O)COC1 |
| InChI | InChI=1S/C15H12Br2ClNO7/c1-24-14(22)6-4-26-5-19(11(6)15(23)25-2)12-8(17)3-7(16)10(18)9(12)13(20)21/h3H,4-5H2,1-2H3,(H,20,21) |
| InChIKey | UMKCBHSORWOZGV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|