C15H13BrN2O9 — CID 168632569
4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3-bromo-5-nitrobenzoic acid (PubChem CID 168632569) has the molecular formula C15H13BrN2O9 and a molecular weight of 445.18 g/mol. Its IUPAC name is 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3-bromo-5-nitrobenzoic acid.
| Compound Name | 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3-bromo-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168632569 |
| Molecular Formula | C15H13BrN2O9 |
| Molecular Weight | 445.18 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 4-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-3-bromo-5-nitrobenzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(Br)cc(C(=O)O)cc2[N+](=O)[O-])COC1 |
| InChI | InChI=1S/C15H13BrN2O9/c1-25-14(21)8-5-27-6-17(11(8)15(22)26-2)12-9(16)3-7(13(19)20)4-10(12)18(23)24/h3-4H,5-6H2,1-2H3,(H,19,20) |
| InChIKey | HCRWMNKSTGIBPH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|