C14H13N3O9 — CID 168635198
dimethyl 3-(3,4-dinitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635198) has the molecular formula C14H13N3O9 and a molecular weight of 367.27 g/mol. Its IUPAC name is dimethyl 3-(3,4-dinitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3,4-dinitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635198 |
| Molecular Formula | C14H13N3O9 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | dimethyl 3-(3,4-dinitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc([N+](=O)[O-])c([N+](=O)[O-])c2)COC1 |
| InChI | InChI=1S/C14H13N3O9/c1-24-13(18)9-6-26-7-15(12(9)14(19)25-2)8-3-4-10(16(20)21)11(5-8)17(22)23/h3-5H,6-7H2,1-2H3 |
| InChIKey | PEBGMEHVUMFJIV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|