C19H22N4O9 — CID 168635415
dimethyl 3-(2,4-dinitro-5-piperidin-1-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635415) has the molecular formula C19H22N4O9 and a molecular weight of 450.40 g/mol. Its IUPAC name is dimethyl 3-(2,4-dinitro-5-piperidin-1-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(2,4-dinitro-5-piperidin-1-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635415 |
| Molecular Formula | C19H22N4O9 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | dimethyl 3-(2,4-dinitro-5-piperidin-1-ylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(N3CCCCC3)c([N+](=O)[O-])cc2[N+](=O)[O-])COC1 |
| InChI | InChI=1S/C19H22N4O9/c1-30-18(24)12-10-32-11-21(17(12)19(25)31-2)14-8-13(20-6-4-3-5-7-20)15(22(26)27)9-16(14)23(28)29/h8-9H,3-7,10-11H2,1-2H3 |
| InChIKey | QITMTNHBZYZKHD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 154.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|