C14H13ClN2O7 — CID 168635945
dimethyl 3-(2-chloro-5-nitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635945) has the molecular formula C14H13ClN2O7 and a molecular weight of 356.72 g/mol. Its IUPAC name is dimethyl 3-(2-chloro-5-nitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(2-chloro-5-nitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635945 |
| Molecular Formula | C14H13ClN2O7 |
| Molecular Weight | 356.72 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | dimethyl 3-(2-chloro-5-nitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc([N+](=O)[O-])ccc2Cl)COC1 |
| InChI | InChI=1S/C14H13ClN2O7/c1-22-13(18)9-6-24-7-16(12(9)14(19)23-2)11-5-8(17(20)21)3-4-10(11)15/h3-5H,6-7H2,1-2H3 |
| InChIKey | VMMOYCZQANTHQC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.72 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|