C14H14N2O8 — CID 168634883
dimethyl 3-(3-hydroxy-5-nitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168634883) has the molecular formula C14H14N2O8 and a molecular weight of 338.27 g/mol. Its IUPAC name is dimethyl 3-(3-hydroxy-5-nitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3-hydroxy-5-nitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168634883 |
| Molecular Formula | C14H14N2O8 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | dimethyl 3-(3-hydroxy-5-nitrophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(O)cc([N+](=O)[O-])c2)COC1 |
| InChI | InChI=1S/C14H14N2O8/c1-22-13(18)11-6-24-7-15(12(11)14(19)23-2)8-3-9(16(20)21)5-10(17)4-8/h3-5,17H,6-7H2,1-2H3 |
| InChIKey | SVCRGXVKNLSPDZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|