C15H13F3INO5 — CID 168635027
dimethyl 3-[3-iodo-4-(trifluoromethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635027) has the molecular formula C15H13F3INO5 and a molecular weight of 471.17 g/mol. Its IUPAC name is dimethyl 3-[3-iodo-4-(trifluoromethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-iodo-4-(trifluoromethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635027 |
| Molecular Formula | C15H13F3INO5 |
| Molecular Weight | 471.17 g/mol |
| Exact Mass | 470.98 |
| IUPAC Name | dimethyl 3-[3-iodo-4-(trifluoromethyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C(F)(F)F)c(I)c2)COC1 |
| InChI | InChI=1S/C15H13F3INO5/c1-23-13(21)9-6-25-7-20(12(9)14(22)24-2)8-3-4-10(11(19)5-8)15(16,17)18/h3-5H,6-7H2,1-2H3 |
| InChIKey | OJEGDFPXFLCXMW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|