C18H17F6NO7 — CID 168633456
dimethyl 3-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168633456) has the molecular formula C18H17F6NO7 and a molecular weight of 473.32 g/mol. Its IUPAC name is dimethyl 3-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168633456 |
| Molecular Formula | C18H17F6NO7 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | dimethyl 3-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)COC1 |
| InChI | InChI=1S/C18H17F6NO7/c1-28-15(26)13-6-30-9-25(14(13)16(27)29-2)10-3-11(31-7-17(19,20)21)5-12(4-10)32-8-18(22,23)24/h3-5H,6-9H2,1-2H3 |
| InChIKey | MTOUIKATQWCNDH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |