C17H20FNO7 — CID 168636106
dimethyl 3-[4-(dimethoxymethyl)-3-fluorophenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168636106) has the molecular formula C17H20FNO7 and a molecular weight of 369.35 g/mol. Its IUPAC name is dimethyl 3-[4-(dimethoxymethyl)-3-fluorophenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-(dimethoxymethyl)-3-fluorophenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168636106 |
| Molecular Formula | C17H20FNO7 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | dimethyl 3-[4-(dimethoxymethyl)-3-fluorophenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C(OC)OC)c(F)c2)COC1 |
| InChI | InChI=1S/C17H20FNO7/c1-22-15(20)12-8-26-9-19(14(12)16(21)23-2)10-5-6-11(13(18)7-10)17(24-3)25-4/h5-7,17H,8-9H2,1-4H3 |
| InChIKey | ODTCNLZOQIMLLZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|