C17H18FNO7 — CID 168631851
dimethyl 3-(3-ethoxycarbonyl-4-fluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168631851) has the molecular formula C17H18FNO7 and a molecular weight of 367.33 g/mol. Its IUPAC name is dimethyl 3-(3-ethoxycarbonyl-4-fluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3-ethoxycarbonyl-4-fluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168631851 |
| Molecular Formula | C17H18FNO7 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | dimethyl 3-(3-ethoxycarbonyl-4-fluorophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(N2COCC(C(=O)OC)=C2C(=O)OC)ccc1F |
| InChI | InChI=1S/C17H18FNO7/c1-4-26-16(21)11-7-10(5-6-13(11)18)19-9-25-8-12(15(20)23-2)14(19)17(22)24-3/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | TZMRQWRPYPIKRE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|