C17H17I2NO7 — CID 168633476
dimethyl 3-(4-ethoxycarbonyl-2,6-diiodophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168633476) has the molecular formula C17H17I2NO7 and a molecular weight of 601.13 g/mol. Its IUPAC name is dimethyl 3-(4-ethoxycarbonyl-2,6-diiodophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(4-ethoxycarbonyl-2,6-diiodophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168633476 |
| Molecular Formula | C17H17I2NO7 |
| Molecular Weight | 601.13 g/mol |
| Exact Mass | 600.91 |
| IUPAC Name | dimethyl 3-(4-ethoxycarbonyl-2,6-diiodophenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(I)c(N2COCC(C(=O)OC)=C2C(=O)OC)c(I)c1 |
| InChI | InChI=1S/C17H17I2NO7/c1-4-27-15(21)9-5-11(18)14(12(19)6-9)20-8-26-7-10(16(22)24-2)13(20)17(23)25-3/h5-6H,4,7-8H2,1-3H3 |
| InChIKey | JQJWKUXADRCSAP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|