C13H13ClIN3 — CID 107608587
1-(2-chloro-4-iodophenyl)-4,5,6,7-tetrahydroindazol-3-amine (PubChem CID 107608587) has the molecular formula C13H13ClIN3 and a molecular weight of 373.63 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-4,5,6,7-tetrahydroindazol-3-amine.
| Compound Name | 1-(2-chloro-4-iodophenyl)-4,5,6,7-tetrahydroindazol-3-amine |
|---|---|
| PubChem CID | 107608587 |
| Molecular Formula | C13H13ClIN3 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-4,5,6,7-tetrahydroindazol-3-amine |
| SMILES | Nc1nn(-c2ccc(I)cc2Cl)c2c1CCCC2 |
| InChI | InChI=1S/C13H13ClIN3/c14-10-7-8(15)5-6-12(10)18-11-4-2-1-3-9(11)13(16)17-18/h5-7H,1-4H2,(H2,16,17) |
| InChIKey | CTYINEKYEDGOPO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|