C14H12ClIN2O2 — CID 107607130
1-(2-chloro-4-iodophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 107607130) has the molecular formula C14H12ClIN2O2 and a molecular weight of 402.62 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
| Compound Name | 1-(2-chloro-4-iodophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107607130 |
| Molecular Formula | C14H12ClIN2O2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2ccc(I)cc2Cl)c2c1CCCC2 |
| InChI | InChI=1S/C14H12ClIN2O2/c15-10-7-8(16)5-6-12(10)18-11-4-2-1-3-9(11)13(17-18)14(19)20/h5-7H,1-4H2,(H,19,20) |
| InChIKey | HAVRBBPOXIWKSU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|