C14H12Cl2N2O2 — CID 16778003
1-(2,3-dichlorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 16778003) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
| Compound Name | 1-(2,3-dichlorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 16778003 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2cccc(Cl)c2Cl)c2c1CCCC2 |
| InChI | InChI=1S/C14H12Cl2N2O2/c15-9-5-3-7-11(12(9)16)18-10-6-2-1-4-8(10)13(17-18)14(19)20/h3,5,7H,1-2,4,6H2,(H,19,20) |
| InChIKey | FOPILAQTHMXQEY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |