C12H11BrIN3 — CID 114261535
1-(4-bromo-3-iodophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-amine (PubChem CID 114261535) has the molecular formula C12H11BrIN3 and a molecular weight of 404.05 g/mol. Its IUPAC name is 1-(4-bromo-3-iodophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-amine.
| Compound Name | 1-(4-bromo-3-iodophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-amine |
|---|---|
| PubChem CID | 114261535 |
| Molecular Formula | C12H11BrIN3 |
| Molecular Weight | 404.05 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | 1-(4-bromo-3-iodophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-amine |
| SMILES | Nc1nn(-c2ccc(Br)c(I)c2)c2c1CCC2 |
| InChI | InChI=1S/C12H11BrIN3/c13-9-5-4-7(6-10(9)14)17-11-3-1-2-8(11)12(15)16-17/h4-6H,1-3H2,(H2,15,16) |
| InChIKey | RNCUKNKLLBHXSZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.05 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|