C17H17N3 — CID 102942370
1-naphthalen-2-yl-4,5,6,7-tetrahydroindazol-3-amine (PubChem CID 102942370) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-naphthalen-2-yl-4,5,6,7-tetrahydroindazol-3-amine.
| Compound Name | 1-naphthalen-2-yl-4,5,6,7-tetrahydroindazol-3-amine |
|---|---|
| PubChem CID | 102942370 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-naphthalen-2-yl-4,5,6,7-tetrahydroindazol-3-amine |
| SMILES | Nc1nn(-c2ccc3ccccc3c2)c2c1CCCC2 |
| InChI | InChI=1S/C17H17N3/c18-17-15-7-3-4-8-16(15)20(19-17)14-10-9-12-5-1-2-6-13(12)11-14/h1-2,5-6,9-11H,3-4,7-8H2,(H2,18,19) |
| InChIKey | GDUYECPHGBAXEG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |