C13H12Cl3N3 — CID 102942490
1-(2,4,6-trichlorophenyl)-4,5,6,7-tetrahydroindazol-3-amine (PubChem CID 102942490) has the molecular formula C13H12Cl3N3 and a molecular weight of 316.62 g/mol. Its IUPAC name is 1-(2,4,6-trichlorophenyl)-4,5,6,7-tetrahydroindazol-3-amine.
| Compound Name | 1-(2,4,6-trichlorophenyl)-4,5,6,7-tetrahydroindazol-3-amine |
|---|---|
| PubChem CID | 102942490 |
| Molecular Formula | C13H12Cl3N3 |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1-(2,4,6-trichlorophenyl)-4,5,6,7-tetrahydroindazol-3-amine |
| SMILES | Nc1nn(-c2c(Cl)cc(Cl)cc2Cl)c2c1CCCC2 |
| InChI | InChI=1S/C13H12Cl3N3/c14-7-5-9(15)12(10(16)6-7)19-11-4-2-1-3-8(11)13(17)18-19/h5-6H,1-4H2,(H2,17,18) |
| InChIKey | NKQZCRDQLDICJM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |