C13H13FN4O2 — CID 102942606
1-(4-fluoro-2-nitrophenyl)-4,5,6,7-tetrahydroindazol-3-amine (PubChem CID 102942606) has the molecular formula C13H13FN4O2 and a molecular weight of 276.27 g/mol. Its IUPAC name is 1-(4-fluoro-2-nitrophenyl)-4,5,6,7-tetrahydroindazol-3-amine.
| Compound Name | 1-(4-fluoro-2-nitrophenyl)-4,5,6,7-tetrahydroindazol-3-amine |
|---|---|
| PubChem CID | 102942606 |
| Molecular Formula | C13H13FN4O2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-(4-fluoro-2-nitrophenyl)-4,5,6,7-tetrahydroindazol-3-amine |
| SMILES | Nc1nn(-c2ccc(F)cc2[N+](=O)[O-])c2c1CCCC2 |
| InChI | InChI=1S/C13H13FN4O2/c14-8-5-6-11(12(7-8)18(19)20)17-10-4-2-1-3-9(10)13(15)16-17/h5-7H,1-4H2,(H2,15,16) |
| InChIKey | IMOQDRCSDCDOFC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|