C17H16ClN5OS — CID 50879793
[4-[2-chloro-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 50879793) has the molecular formula C17H16ClN5OS and a molecular weight of 373.87 g/mol. Its IUPAC name is [4-[2-chloro-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[2-chloro-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 50879793 |
| Molecular Formula | C17H16ClN5OS |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | [4-[2-chloro-4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(c2ccc(-n3cnnc3)cc2Cl)CC1 |
| InChI | InChI=1S/C17H16ClN5OS/c18-14-10-13(23-11-19-20-12-23)3-4-15(14)21-5-7-22(8-6-21)17(24)16-2-1-9-25-16/h1-4,9-12H,5-8H2 |
| InChIKey | VBVLJYKZMGNQEG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|