C19H17ClN4O2S — CID 2958911
4-chloro-2-phenyl-5-[4-(thiophene-2-carbonyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 2958911) has the molecular formula C19H17ClN4O2S and a molecular weight of 400.89 g/mol. Its IUPAC name is 4-chloro-2-phenyl-5-[4-(thiophene-2-carbonyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-chloro-2-phenyl-5-[4-(thiophene-2-carbonyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 2958911 |
| Molecular Formula | C19H17ClN4O2S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-chloro-2-phenyl-5-[4-(thiophene-2-carbonyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | O=C(c1cccs1)N1CCN(c2cnn(-c3ccccc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C19H17ClN4O2S/c20-17-15(13-21-24(19(17)26)14-5-2-1-3-6-14)22-8-10-23(11-9-22)18(25)16-7-4-12-27-16/h1-7,12-13H,8-11H2 |
| InChIKey | WOTWQIXDHBTWHL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |