C26H29ClN4O3 — CID 26702611
4-chloro-5-[4-[4-(3-methylbutoxy)benzoyl]piperazin-1-yl]-2-phenylpyridazin-3-one (PubChem CID 26702611) has the molecular formula C26H29ClN4O3 and a molecular weight of 481.00 g/mol. Its IUPAC name is 4-chloro-5-[4-[4-(3-methylbutoxy)benzoyl]piperazin-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[4-[4-(3-methylbutoxy)benzoyl]piperazin-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 26702611 |
| Molecular Formula | C26H29ClN4O3 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 4-chloro-5-[4-[4-(3-methylbutoxy)benzoyl]piperazin-1-yl]-2-phenylpyridazin-3-one |
| SMILES | CC(C)CCOc1ccc(C(=O)N2CCN(c3cnn(-c4ccccc4)c(=O)c3Cl)CC2)cc1 |
| InChI | InChI=1S/C26H29ClN4O3/c1-19(2)12-17-34-22-10-8-20(9-11-22)25(32)30-15-13-29(14-16-30)23-18-28-31(26(33)24(23)27)21-6-4-3-5-7-21/h3-11,18-19H,12-17H2,1-2H3 |
| InChIKey | RLISVFTUDVSHSP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |