C14H11F4N3OS — CID 133370657
[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 133370657) has the molecular formula C14H11F4N3OS and a molecular weight of 345.32 g/mol. Its IUPAC name is [4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 133370657 |
| Molecular Formula | C14H11F4N3OS |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | [4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C14H11F4N3OS/c15-9-11(10(16)13(18)19-12(9)17)20-3-5-21(6-4-20)14(22)8-2-1-7-23-8/h1-2,7H,3-6H2 |
| InChIKey | WFZXBUCVILIMRG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|