C15H13F4N3OS — CID 133372675
[4-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone (PubChem CID 133372675) has the molecular formula C15H13F4N3OS and a molecular weight of 359.35 g/mol. Its IUPAC name is [4-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 133372675 |
| Molecular Formula | C15H13F4N3OS |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | [4-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,4-diazepan-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C15H13F4N3OS/c16-10-12(11(17)14(19)20-13(10)18)21-4-2-5-22(7-6-21)15(23)9-3-1-8-24-9/h1,3,8H,2,4-7H2 |
| InChIKey | QCBSGEQPNRPOPF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|