C24H26N2O4 — CID 23036453
(E)-but-2-enedioic acid;2,2-diphenyl-3-piperidin-3-ylpropanenitrile (PubChem CID 23036453) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2,2-diphenyl-3-piperidin-3-ylpropanenitrile.
| Compound Name | (E)-but-2-enedioic acid;2,2-diphenyl-3-piperidin-3-ylpropanenitrile |
|---|---|
| PubChem CID | 23036453 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (E)-but-2-enedioic acid;2,2-diphenyl-3-piperidin-3-ylpropanenitrile |
| SMILES | N#CC(CC1CCCNC1)(c1ccccc1)c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H22N2.C4H4O4/c21-16-20(18-9-3-1-4-10-18,19-11-5-2-6-12-19)14-17-8-7-13-22-15-17;5-3(6)1-2-4(7)8/h1-6,9-12,17,22H,7-8,13-15H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XPPZLUKNBVUYAQ-WLHGVMLRSA-N |
| XLogP | 3.60 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|