C24H24F6 — CID 162555954
5-[4-(4-but-3-enylcyclohexyl)-2-fluorophenyl]-1,3-difluoro-2-(2,2,2-trifluoroethyl)benzene (PubChem CID 162555954) has the molecular formula C24H24F6 and a molecular weight of 426.44 g/mol. Its IUPAC name is 5-[4-(4-but-3-enylcyclohexyl)-2-fluorophenyl]-1,3-difluoro-2-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 5-[4-(4-but-3-enylcyclohexyl)-2-fluorophenyl]-1,3-difluoro-2-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 162555954 |
| Molecular Formula | C24H24F6 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 5-[4-(4-but-3-enylcyclohexyl)-2-fluorophenyl]-1,3-difluoro-2-(2,2,2-trifluoroethyl)benzene |
| SMILES | C=CCCC1CCC(c2ccc(-c3cc(F)c(CC(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H24F6/c1-2-3-4-15-5-7-16(8-6-15)17-9-10-19(21(25)11-17)18-12-22(26)20(23(27)13-18)14-24(28,29)30/h2,9-13,15-16H,1,3-8,14H2 |
| InChIKey | FSFGIHPNPVYYJB-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|