C23H26FNO3 — CID 70262927
4-(2-cyanophenyl)-4-[4-(ethoxymethyl)cyclohexyl]-3-fluorocyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 70262927) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is 4-(2-cyanophenyl)-4-[4-(ethoxymethyl)cyclohexyl]-3-fluorocyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-(2-cyanophenyl)-4-[4-(ethoxymethyl)cyclohexyl]-3-fluorocyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 70262927 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 4-(2-cyanophenyl)-4-[4-(ethoxymethyl)cyclohexyl]-3-fluorocyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCOCC1CCC(C2(c3ccccc3C#N)C=CC(C(=O)O)C=C2F)CC1 |
| InChI | InChI=1S/C23H26FNO3/c1-2-28-15-16-7-9-19(10-8-16)23(20-6-4-3-5-18(20)14-25)12-11-17(22(26)27)13-21(23)24/h3-6,11-13,16-17,19H,2,7-10,15H2,1H3,(H,26,27) |
| InChIKey | CJHPXFPOIXYTQL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|