About ethylcyclopropane;2-(trifluoromethyl)benzonitrile
ethylcyclopropane;2-(trifluoromethyl)benzonitrile (PubChem CID 157032231) has the molecular formula C13H14F3N
and a molecular weight of 241.26 g/mol. Its IUPAC name is ethylcyclopropane;2-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | ethylcyclopropane;2-(trifluoromethyl)benzonitrile |
| PubChem CID | 157032231 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethylcyclopropane;2-(trifluoromethyl)benzonitrile |
| SMILES | CCC1CC1.N#Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C8H4F3N.C5H10/c9-8(10,11)7-4-2-1-3-6(7)5-12;1-2-5-3-4-5/h1-4H;5H,2-4H2,1H3 |
| InChIKey | QEINYFMPLTWECE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethylcyclopropane;2-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylcyclopropane;2-(trifluoromethyl)benzonitrile?
The IUPAC name of ethylcyclopropane;2-(trifluoromethyl)benzonitrile (CID 157032231) is ethylcyclopropane;2-(trifluoromethyl)benzonitrile.
What is the SMILES notation for ethylcyclopropane;2-(trifluoromethyl)benzonitrile?
The canonical SMILES for ethylcyclopropane;2-(trifluoromethyl)benzonitrile is CCC1CC1.N#Cc1ccccc1C(F)(F)F.
What is the InChIKey of ethylcyclopropane;2-(trifluoromethyl)benzonitrile?
The InChIKey is QEINYFMPLTWECE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3N.C5H10/c9-8(10,11)7-4-2-1-3-6(7)5-12;1-2-5-3-4-5/h1-4H;5H,2-4H2,1H3.
What are the key properties of ethylcyclopropane;2-(trifluoromethyl)benzonitrile?
ethylcyclopropane;2-(trifluoromethyl)benzonitrile has a molecular weight of 241.26 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylcyclopropane;2-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 157032231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).