C12H9F4N — CID 177481708
2-(1,1,1,2-tetrafluoropent-4-en-2-yl)benzonitrile (PubChem CID 177481708) has the molecular formula C12H9F4N and a molecular weight of 243.20 g/mol. Its IUPAC name is 2-(1,1,1,2-tetrafluoropent-4-en-2-yl)benzonitrile.
| Compound Name | 2-(1,1,1,2-tetrafluoropent-4-en-2-yl)benzonitrile |
|---|---|
| PubChem CID | 177481708 |
| Molecular Formula | C12H9F4N |
| Molecular Weight | 243.20 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-(1,1,1,2-tetrafluoropent-4-en-2-yl)benzonitrile |
| SMILES | C=CCC(F)(c1ccccc1C#N)C(F)(F)F |
| InChI | InChI=1S/C12H9F4N/c1-2-7-11(13,12(14,15)16)10-6-4-3-5-9(10)8-17/h2-6H,1,7H2 |
| InChIKey | MMBOKUIOPIEFLJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|