C16H8Cl4N2 — CID 11726603
2-[1,1,2,2-tetrachloro-2-(2-cyanophenyl)ethyl]benzonitrile (PubChem CID 11726603) has the molecular formula C16H8Cl4N2 and a molecular weight of 370.07 g/mol. Its IUPAC name is 2-[1,1,2,2-tetrachloro-2-(2-cyanophenyl)ethyl]benzonitrile.
| Compound Name | 2-[1,1,2,2-tetrachloro-2-(2-cyanophenyl)ethyl]benzonitrile |
|---|---|
| PubChem CID | 11726603 |
| Molecular Formula | C16H8Cl4N2 |
| Molecular Weight | 370.07 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | 2-[1,1,2,2-tetrachloro-2-(2-cyanophenyl)ethyl]benzonitrile |
| SMILES | N#Cc1ccccc1C(Cl)(Cl)C(Cl)(Cl)c1ccccc1C#N |
| InChI | InChI=1S/C16H8Cl4N2/c17-15(18,13-7-3-1-5-11(13)9-21)16(19,20)14-8-4-2-6-12(14)10-22/h1-8H |
| InChIKey | NVQPKHMDUAJFGO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.07 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|