C12H14NO3P-2 — CID 86737208
2-(3-phosphonatopentan-3-yl)benzonitrile (PubChem CID 86737208) has the molecular formula C12H14NO3P-2 and a molecular weight of 251.22 g/mol. Its IUPAC name is 2-(3-phosphonatopentan-3-yl)benzonitrile.
| Compound Name | 2-(3-phosphonatopentan-3-yl)benzonitrile |
|---|---|
| PubChem CID | 86737208 |
| Molecular Formula | C12H14NO3P-2 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(3-phosphonatopentan-3-yl)benzonitrile |
| SMILES | CCC(CC)(c1ccccc1C#N)P(=O)([O-])[O-] |
| InChI | InChI=1S/C12H16NO3P/c1-3-12(4-2,17(14,15)16)11-8-6-5-7-10(11)9-13/h5-8H,3-4H2,1-2H3,(H2,14,15,16)/p-2 |
| InChIKey | TWSAVNKDDKZPHO-UHFFFAOYSA-L |
| XLogP | 1.49 |
| TPSA | 86.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|