C27H35FO6 — CID 70301142
4-decanoyloxy-3-fluoro-4-(2-propoxycarbonylphenyl)cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 70301142) has the molecular formula C27H35FO6 and a molecular weight of 474.57 g/mol. Its IUPAC name is 4-decanoyloxy-3-fluoro-4-(2-propoxycarbonylphenyl)cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-decanoyloxy-3-fluoro-4-(2-propoxycarbonylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 70301142 |
| Molecular Formula | C27H35FO6 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 4-decanoyloxy-3-fluoro-4-(2-propoxycarbonylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCCCCCCC(=O)OC1(c2ccccc2C(=O)OCCC)C=CC(C(=O)O)C=C1F |
| InChI | InChI=1S/C27H35FO6/c1-3-5-6-7-8-9-10-15-24(29)34-27(17-16-20(25(30)31)19-23(27)28)22-14-12-11-13-21(22)26(32)33-18-4-2/h11-14,16-17,19-20H,3-10,15,18H2,1-2H3,(H,30,31) |
| InChIKey | BYXHPQZGXULXAF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|