C32H46O6 — CID 70301247
4-decanoyloxy-4-[2-[(2R)-octan-2-yl]oxycarbonylphenyl]cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 70301247) has the molecular formula C32H46O6 and a molecular weight of 526.71 g/mol. Its IUPAC name is 4-decanoyloxy-4-[2-[(2R)-octan-2-yl]oxycarbonylphenyl]cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-decanoyloxy-4-[2-[(2R)-octan-2-yl]oxycarbonylphenyl]cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 70301247 |
| Molecular Formula | C32H46O6 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 4-decanoyloxy-4-[2-[(2R)-octan-2-yl]oxycarbonylphenyl]cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCCCCCCC(=O)OC1(c2ccccc2C(=O)O[C@H](C)CCCCCC)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C32H46O6/c1-4-6-8-10-11-12-14-20-29(33)38-32(23-21-26(22-24-32)30(34)35)28-19-16-15-18-27(28)31(36)37-25(3)17-13-9-7-5-2/h15-16,18-19,21-26H,4-14,17,20H2,1-3H3,(H,34,35)/t25-,26?,32?/m1/s1 |
| InChIKey | AAIQERJBJJDBRR-WTUPZXKFSA-N |
| XLogP | 7.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|