C37H48O6 — CID 67930145
4-(4-nonanoyloxyphenyl)-1-(2-octan-2-yloxycarbonylphenyl)cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 67930145) has the molecular formula C37H48O6 and a molecular weight of 588.79 g/mol. Its IUPAC name is 4-(4-nonanoyloxyphenyl)-1-(2-octan-2-yloxycarbonylphenyl)cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-(4-nonanoyloxyphenyl)-1-(2-octan-2-yloxycarbonylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67930145 |
| Molecular Formula | C37H48O6 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | 4-(4-nonanoyloxyphenyl)-1-(2-octan-2-yloxycarbonylphenyl)cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCCCCCC(=O)Oc1ccc(C2C=CC(C(=O)O)(c3ccccc3C(=O)OC(C)CCCCCC)C=C2)cc1 |
| InChI | InChI=1S/C37H48O6/c1-4-6-8-10-11-13-19-34(38)43-31-22-20-29(21-23-31)30-24-26-37(27-25-30,36(40)41)33-18-15-14-17-32(33)35(39)42-28(3)16-12-9-7-5-2/h14-15,17-18,20-28,30H,4-13,16,19H2,1-3H3,(H,40,41) |
| InChIKey | RKILEVVBNJCMEM-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|