C34H42O7 — CID 70397810
[(2R)-octan-2-yl] 4-[4-phenyl-1-[(2S)-2-propoxypropanoyl]oxycyclohexa-2,5-diene-1-carbonyl]oxybenzoate (PubChem CID 70397810) has the molecular formula C34H42O7 and a molecular weight of 562.70 g/mol. Its IUPAC name is [(2R)-octan-2-yl] 4-[4-phenyl-1-[(2S)-2-propoxypropanoyl]oxycyclohexa-2,5-diene-1-carbonyl]oxybenzoate.
| Compound Name | [(2R)-octan-2-yl] 4-[4-phenyl-1-[(2S)-2-propoxypropanoyl]oxycyclohexa-2,5-diene-1-carbonyl]oxybenzoate |
|---|---|
| PubChem CID | 70397810 |
| Molecular Formula | C34H42O7 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | [(2R)-octan-2-yl] 4-[4-phenyl-1-[(2S)-2-propoxypropanoyl]oxycyclohexa-2,5-diene-1-carbonyl]oxybenzoate |
| SMILES | CCCCCC[C@@H](C)OC(=O)c1ccc(OC(=O)C2(OC(=O)[C@H](C)OCCC)C=CC(c3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C34H42O7/c1-5-7-8-10-13-25(3)39-32(36)29-16-18-30(19-17-29)40-33(37)34(41-31(35)26(4)38-24-6-2)22-20-28(21-23-34)27-14-11-9-12-15-27/h9,11-12,14-23,25-26,28H,5-8,10,13,24H2,1-4H3/t25-,26+,28?,34?/m1/s1 |
| InChIKey | KYGUUPMBQBGSLZ-CYWSBNPCSA-N |
| XLogP | 7.11 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|