C33H40O7 — CID 70398440
[4-[3-oxo-3-[(2S)-pentan-2-yl]oxypropyl]phenyl] 4-phenyl-1-[(2S)-2-propoxypropanoyl]oxycyclohexa-2,5-diene-1-carboxylate (PubChem CID 70398440) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is [4-[3-oxo-3-[(2S)-pentan-2-yl]oxypropyl]phenyl] 4-phenyl-1-[(2S)-2-propoxypropanoyl]oxycyclohexa-2,5-diene-1-carboxylate.
| Compound Name | [4-[3-oxo-3-[(2S)-pentan-2-yl]oxypropyl]phenyl] 4-phenyl-1-[(2S)-2-propoxypropanoyl]oxycyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 70398440 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | [4-[3-oxo-3-[(2S)-pentan-2-yl]oxypropyl]phenyl] 4-phenyl-1-[(2S)-2-propoxypropanoyl]oxycyclohexa-2,5-diene-1-carboxylate |
| SMILES | CCCO[C@@H](C)C(=O)OC1(C(=O)Oc2ccc(CCC(=O)O[C@@H](C)CCC)cc2)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C33H40O7/c1-5-10-24(3)38-30(34)18-15-26-13-16-29(17-14-26)39-32(36)33(40-31(35)25(4)37-23-6-2)21-19-28(20-22-33)27-11-8-7-9-12-27/h7-9,11-14,16-17,19-22,24-25,28H,5-6,10,15,18,23H2,1-4H3/t24-,25-,28?,33?/m0/s1 |
| InChIKey | FHXVRHMZZOFNSK-UVWZBJBXSA-N |
| XLogP | 6.26 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|