pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate

C14H19ClO4S — CID 102988359

IUPACpentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate
SMILESCCCC(C)OC(=O)CCc1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C14H19ClO4S/c1-3-4-11(2)19-14(16)10-7-12-5-8-13(9-6-12)20(15,17)18/h5-6,8-9,11H,3-4,7,10H2,1-2H3
InChIKeyJIZVIFZVAYMFDW-UHFFFAOYSA-N
MW318.82 g/mol
LogP3.28
Rot. Bonds7

About pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate

pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate (PubChem CID 102988359) has the molecular formula C14H19ClO4S and a molecular weight of 318.82 g/mol. Its IUPAC name is pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate.

Molecular Properties

Compound Namepentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate
PubChem CID102988359
Molecular FormulaC14H19ClO4S
Molecular Weight318.82 g/mol
Exact Mass318.07
IUPAC Namepentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate
SMILESCCCC(C)OC(=O)CCc1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C14H19ClO4S/c1-3-4-11(2)19-14(16)10-7-12-5-8-13(9-6-12)20(15,17)18/h5-6,8-9,11H,3-4,7,10H2,1-2H3
InChIKeyJIZVIFZVAYMFDW-UHFFFAOYSA-N
XLogP3.28
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.82
LogP ≤ 53.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate?
The IUPAC name of pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate (CID 102988359) is pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate.
What is the SMILES notation for pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate?
The canonical SMILES for pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate is CCCC(C)OC(=O)CCc1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate?
The InChIKey is JIZVIFZVAYMFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClO4S/c1-3-4-11(2)19-14(16)10-7-12-5-8-13(9-6-12)20(15,17)18/h5-6,8-9,11H,3-4,7,10H2,1-2H3.
What are the key properties of pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate?
pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate has a molecular weight of 318.82 g/mol, XLogP of 3.28, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 3-(4-chlorosulfonylphenyl)propanoate is sourced from PubChem (CID 102988359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).