C33H41ClO4 — CID 142642329
(4-octan-2-yloxycarbonylphenyl) 6-chloro-1-pentyl-4-phenylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 142642329) has the molecular formula C33H41ClO4 and a molecular weight of 537.14 g/mol. Its IUPAC name is (4-octan-2-yloxycarbonylphenyl) 6-chloro-1-pentyl-4-phenylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | (4-octan-2-yloxycarbonylphenyl) 6-chloro-1-pentyl-4-phenylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 142642329 |
| Molecular Formula | C33H41ClO4 |
| Molecular Weight | 537.14 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | (4-octan-2-yloxycarbonylphenyl) 6-chloro-1-pentyl-4-phenylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCCCC(C)OC(=O)c1ccc(OC(=O)C2(CCCCC)C=CC(c3ccccc3)=CC2Cl)cc1 |
| InChI | InChI=1S/C33H41ClO4/c1-4-6-8-10-14-25(3)37-31(35)27-17-19-29(20-18-27)38-32(36)33(22-13-7-5-2)23-21-28(24-30(33)34)26-15-11-9-12-16-26/h9,11-12,15-21,23-25,30H,4-8,10,13-14,22H2,1-3H3 |
| InChIKey | POEXQEMDXBKBNG-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.14 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|