C36H48O5 — CID 67789808
1-(2-octan-2-yloxycarbonylphenyl)-4-(4-octoxyphenyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67789808) has the molecular formula C36H48O5 and a molecular weight of 560.78 g/mol. Its IUPAC name is 1-(2-octan-2-yloxycarbonylphenyl)-4-(4-octoxyphenyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 1-(2-octan-2-yloxycarbonylphenyl)-4-(4-octoxyphenyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67789808 |
| Molecular Formula | C36H48O5 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | 1-(2-octan-2-yloxycarbonylphenyl)-4-(4-octoxyphenyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCCCCCCOc1ccc(C2=CCC(C(=O)O)(c3ccccc3C(=O)OC(C)CCCCCC)C=C2)cc1 |
| InChI | InChI=1S/C36H48O5/c1-4-6-8-10-11-15-27-40-31-21-19-29(20-22-31)30-23-25-36(26-24-30,35(38)39)33-18-14-13-17-32(33)34(37)41-28(3)16-12-9-7-5-2/h13-14,17-25,28H,4-12,15-16,26-27H2,1-3H3,(H,38,39) |
| InChIKey | GKPUXMQGSJKIDG-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|