C33H42O5 — CID 67785574
4-(4-octoxyphenyl)-1-(2-pentan-2-yloxycarbonylphenyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67785574) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is 4-(4-octoxyphenyl)-1-(2-pentan-2-yloxycarbonylphenyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-(4-octoxyphenyl)-1-(2-pentan-2-yloxycarbonylphenyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67785574 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 4-(4-octoxyphenyl)-1-(2-pentan-2-yloxycarbonylphenyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCCCCCCOc1ccc(C2=CCC(C(=O)O)(c3ccccc3C(=O)OC(C)CCC)C=C2)cc1 |
| InChI | InChI=1S/C33H42O5/c1-4-6-7-8-9-12-24-37-28-18-16-26(17-19-28)27-20-22-33(23-21-27,32(35)36)30-15-11-10-14-29(30)31(34)38-25(3)13-5-2/h10-11,14-22,25H,4-9,12-13,23-24H2,1-3H3,(H,35,36) |
| InChIKey | SHMITPHZFWKRNV-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|