C36H45F3O7 — CID 67832806
1-[2-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)oxycarbonylphenyl]-4-[4-(1-methoxyhexoxy)phenyl]cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 67832806) has the molecular formula C36H45F3O7 and a molecular weight of 646.74 g/mol. Its IUPAC name is 1-[2-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)oxycarbonylphenyl]-4-[4-(1-methoxyhexoxy)phenyl]cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 1-[2-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)oxycarbonylphenyl]-4-[4-(1-methoxyhexoxy)phenyl]cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67832806 |
| Molecular Formula | C36H45F3O7 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | 1-[2-(7-ethoxy-1,1,1-trifluoroheptan-2-yl)oxycarbonylphenyl]-4-[4-(1-methoxyhexoxy)phenyl]cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCCC(OC)Oc1ccc(C2C=CC(C(=O)O)(c3ccccc3C(=O)OC(CCCCCOCC)C(F)(F)F)C=C2)cc1 |
| InChI | InChI=1S/C36H45F3O7/c1-4-6-8-16-32(43-3)45-28-19-17-26(18-20-28)27-21-23-35(24-22-27,34(41)42)30-14-11-10-13-29(30)33(40)46-31(36(37,38)39)15-9-7-12-25-44-5-2/h10-11,13-14,17-24,27,31-32H,4-9,12,15-16,25H2,1-3H3,(H,41,42) |
| InChIKey | QMVYPPYWHXVQMD-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|