C31H40F4O6 — CID 139725408
[(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl] 3-benzoyloxy-2-fluoro-4-octoxybenzoate (PubChem CID 139725408) has the molecular formula C31H40F4O6 and a molecular weight of 584.65 g/mol. Its IUPAC name is [(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl] 3-benzoyloxy-2-fluoro-4-octoxybenzoate.
| Compound Name | [(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl] 3-benzoyloxy-2-fluoro-4-octoxybenzoate |
|---|---|
| PubChem CID | 139725408 |
| Molecular Formula | C31H40F4O6 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | [(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-yl] 3-benzoyloxy-2-fluoro-4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)O[C@H](CCCCCOCC)C(F)(F)F)c(F)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H40F4O6/c1-3-5-6-7-8-15-22-39-25-20-19-24(27(32)28(25)41-29(36)23-16-11-9-12-17-23)30(37)40-26(31(33,34)35)18-13-10-14-21-38-4-2/h9,11-12,16-17,19-20,26H,3-8,10,13-15,18,21-22H2,1-2H3/t26-/m1/s1 |
| InChIKey | RWXKGSQTQPQUGV-AREMUKBSSA-N |
| XLogP | 8.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|