C31H44O6 — CID 70298168
4-nonanoyloxy-4-[2-[(2R)-octan-2-yl]oxycarbonylphenyl]cyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 70298168) has the molecular formula C31H44O6 and a molecular weight of 512.69 g/mol. Its IUPAC name is 4-nonanoyloxy-4-[2-[(2R)-octan-2-yl]oxycarbonylphenyl]cyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-nonanoyloxy-4-[2-[(2R)-octan-2-yl]oxycarbonylphenyl]cyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 70298168 |
| Molecular Formula | C31H44O6 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 4-nonanoyloxy-4-[2-[(2R)-octan-2-yl]oxycarbonylphenyl]cyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCCCCCC(=O)OC1(c2ccccc2C(=O)O[C@H](C)CCCCCC)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C31H44O6/c1-4-6-8-10-11-13-19-28(32)37-31(22-20-25(21-23-31)29(33)34)27-18-15-14-17-26(27)30(35)36-24(3)16-12-9-7-5-2/h14-15,17-18,20-25H,4-13,16,19H2,1-3H3,(H,33,34)/t24-,25?,31?/m1/s1 |
| InChIKey | FLSDZUOSQPKYRF-BNDRHBIXSA-N |
| XLogP | 7.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|