C17H20O4 — CID 23171707
4-(2-butoxyphenyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 23171707) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-(2-butoxyphenyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 4-(2-butoxyphenyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 23171707 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-(2-butoxyphenyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CCCCOc1ccccc1C1(O)C=CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C17H20O4/c1-2-3-12-21-15-7-5-4-6-14(15)17(20)10-8-13(9-11-17)16(18)19/h4-11,13,20H,2-3,12H2,1H3,(H,18,19) |
| InChIKey | PENHKUISDYCGGQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|